C19H33NOSi — CID 134926878
(2R)-2-[[(E,3R)-2,2-dimethyl-6-trimethylsilylhex-5-en-3-yl]amino]-2-phenylethanol (PubChem CID 134926878) has the molecular formula C19H33NOSi and a molecular weight of 319.56 g/mol. Its IUPAC name is (2R)-2-[[(E,3R)-2,2-dimethyl-6-trimethylsilylhex-5-en-3-yl]amino]-2-phenylethanol.
| Compound Name | (2R)-2-[[(E,3R)-2,2-dimethyl-6-trimethylsilylhex-5-en-3-yl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 134926878 |
| Molecular Formula | C19H33NOSi |
| Molecular Weight | 319.56 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (2R)-2-[[(E,3R)-2,2-dimethyl-6-trimethylsilylhex-5-en-3-yl]amino]-2-phenylethanol |
| SMILES | CC(C)(C)[C@@H](C/C=C/[Si](C)(C)C)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C19H33NOSi/c1-19(2,3)18(13-10-14-22(4,5)6)20-17(15-21)16-11-8-7-9-12-16/h7-12,14,17-18,20-21H,13,15H2,1-6H3/b14-10+/t17-,18+/m0/s1 |
| InChIKey | VEOGOHYDTDXROW-VCCRENGCSA-N |
| XLogP | 4.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|