About (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol
(2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol (PubChem CID 56859290) has the molecular formula C21H29NO
and a molecular weight of 311.47 g/mol. Its IUPAC name is (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol |
| PubChem CID | 56859290 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol |
| SMILES | CC(N[C@H](CO)C(C)(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NO/c1-16(22-19(15-23)21(2,3)4)20(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19-20,22-23H,15H2,1-4H3/t16?,19-/m1/s1 |
| InChIKey | VLKWGOXIAOBZPJ-LRTDYKAYSA-N |
| XLogP | 4.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol?
The IUPAC name of (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol (CID 56859290) is (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol.
What is the SMILES notation for (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol?
The canonical SMILES for (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol is CC(N[C@H](CO)C(C)(C)C)C(c1ccccc1)c1ccccc1.
What is the InChIKey of (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol?
The InChIKey is VLKWGOXIAOBZPJ-LRTDYKAYSA-N. The full InChI is InChI=1S/C21H29NO/c1-16(22-19(15-23)21(2,3)4)20(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19-20,22-23H,15H2,1-4H3/t16?,19-/m1/s1.
What are the key properties of (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol?
(2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol has a molecular weight of 311.47 g/mol, XLogP of 4.20, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(1,1-diphenylpropan-2-ylamino)-3,3-dimethylbutan-1-ol is sourced from PubChem (CID 56859290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).