C18H20N4O3 — CID 134927347
(1S)-2-[4-[4-(aminooxymethyl)phenyl]triazol-1-yl]-1-(3-methoxyphenyl)ethanol (PubChem CID 134927347) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (1S)-2-[4-[4-(aminooxymethyl)phenyl]triazol-1-yl]-1-(3-methoxyphenyl)ethanol.
| Compound Name | (1S)-2-[4-[4-(aminooxymethyl)phenyl]triazol-1-yl]-1-(3-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 134927347 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (1S)-2-[4-[4-(aminooxymethyl)phenyl]triazol-1-yl]-1-(3-methoxyphenyl)ethanol |
| SMILES | COc1cccc([C@H](O)Cn2cc(-c3ccc(CON)cc3)nn2)c1 |
| InChI | InChI=1S/C18H20N4O3/c1-24-16-4-2-3-15(9-16)18(23)11-22-10-17(20-21-22)14-7-5-13(6-8-14)12-25-19/h2-10,18,23H,11-12,19H2,1H3/t18-/m1/s1 |
| InChIKey | VHLDMKBFYSQAQH-GOSISDBHSA-N |
| XLogP | 2.08 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|