C18H24O7S — CID 134928136
(1R,2R,6S,8R,9R)-8-benzylsulfonyl-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 134928136) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is (1R,2R,6S,8R,9R)-8-benzylsulfonyl-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1R,2R,6S,8R,9R)-8-benzylsulfonyl-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 134928136 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (1R,2R,6S,8R,9R)-8-benzylsulfonyl-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](S(=O)(=O)Cc1ccccc1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H24O7S/c1-17(2)22-12-13-15(25-18(3,4)23-13)21-16(14(12)24-17)26(19,20)10-11-8-6-5-7-9-11/h5-9,12-16H,10H2,1-4H3/t12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | SQVATLFLWCRSIF-OXGONZEZSA-N |
| XLogP | 1.96 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |