C19H26O8S — CID 135050552
[(3aR,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] phenylmethanesulfonate (PubChem CID 135050552) has the molecular formula C19H26O8S and a molecular weight of 414.48 g/mol. Its IUPAC name is [(3aR,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] phenylmethanesulfonate.
| Compound Name | [(3aR,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] phenylmethanesulfonate |
|---|---|
| PubChem CID | 135050552 |
| Molecular Formula | C19H26O8S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [(3aR,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] phenylmethanesulfonate |
| SMILES | CC1(C)OCC(C2O[C@@H]3OC(C)(C)O[C@@H]3[C@@H]2OS(=O)(=O)Cc2ccccc2)O1 |
| InChI | InChI=1S/C19H26O8S/c1-18(2)22-10-13(24-18)14-15(16-17(23-14)26-19(3,4)25-16)27-28(20,21)11-12-8-6-5-7-9-12/h5-9,13-17H,10-11H2,1-4H3/t13?,14?,15-,16-,17-/m1/s1 |
| InChIKey | YYLZSSDYLAPVTC-SWHNLWLKSA-N |
| XLogP | 1.93 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|