C17H20O6S — CID 134917376
(1R,2R,4R,8R,9R)-11-benzylsulfanyl-6,6-dimethyl-3,5,7,10,12,14-hexaoxatetracyclo[9.2.1.02,9.04,8]tetradecane (PubChem CID 134917376) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is (1R,2R,4R,8R,9R)-11-benzylsulfanyl-6,6-dimethyl-3,5,7,10,12,14-hexaoxatetracyclo[9.2.1.02,9.04,8]tetradecane.
| Compound Name | (1R,2R,4R,8R,9R)-11-benzylsulfanyl-6,6-dimethyl-3,5,7,10,12,14-hexaoxatetracyclo[9.2.1.02,9.04,8]tetradecane |
|---|---|
| PubChem CID | 134917376 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (1R,2R,4R,8R,9R)-11-benzylsulfanyl-6,6-dimethyl-3,5,7,10,12,14-hexaoxatetracyclo[9.2.1.02,9.04,8]tetradecane |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@@H](OC4(SCc5ccccc5)OC[C@H]3O4)[C@H]2O1 |
| InChI | InChI=1S/C17H20O6S/c1-16(2)21-14-13-12(19-15(14)23-16)11-8-18-17(20-11,22-13)24-9-10-6-4-3-5-7-10/h3-7,11-15H,8-9H2,1-2H3/t11-,12-,13-,14-,15-,17?/m1/s1 |
| InChIKey | GXPGCEWIKXARQU-IMAWRBALSA-N |
| XLogP | 2.22 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |