C22H36O4Si — CID 134928638
[(2S,3S,6S)-3-acetyl-6-[3-tri(propan-2-yl)silylprop-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134928638) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is [(2S,3S,6S)-3-acetyl-6-[3-tri(propan-2-yl)silylprop-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6S)-3-acetyl-6-[3-tri(propan-2-yl)silylprop-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134928638 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | [(2S,3S,6S)-3-acetyl-6-[3-tri(propan-2-yl)silylprop-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C#CC[Si](C(C)C)(C(C)C)C(C)C)C=C[C@@H]1C(C)=O |
| InChI | InChI=1S/C22H36O4Si/c1-15(2)27(16(3)4,17(5)6)13-9-10-20-11-12-21(18(7)23)22(26-20)14-25-19(8)24/h11-12,15-17,20-22H,13-14H2,1-8H3/t20-,21-,22-/m1/s1 |
| InChIKey | HDXSVDFROVOUTE-YPAWHYETSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|