C16H24O4Si — CID 134929139
[(2S,3S,6S)-3-acetyl-6-(1-trimethylsilylpropa-1,2-dienyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134929139) has the molecular formula C16H24O4Si and a molecular weight of 308.45 g/mol. Its IUPAC name is [(2S,3S,6S)-3-acetyl-6-(1-trimethylsilylpropa-1,2-dienyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6S)-3-acetyl-6-(1-trimethylsilylpropa-1,2-dienyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134929139 |
| Molecular Formula | C16H24O4Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [(2S,3S,6S)-3-acetyl-6-(1-trimethylsilylpropa-1,2-dienyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | C=C=C([C@@H]1C=C[C@H](C(C)=O)[C@@H](COC(C)=O)O1)[Si](C)(C)C |
| InChI | InChI=1S/C16H24O4Si/c1-7-16(21(4,5)6)14-9-8-13(11(2)17)15(20-14)10-19-12(3)18/h8-9,13-15H,1,10H2,2-6H3/t13-,14+,15-/m1/s1 |
| InChIKey | FVGGIOGYZHBQGJ-QLFBSQMISA-N |
| XLogP | 2.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|