C21H26O7 — CID 134930928
[(2S,3S,6S)-3-acetyl-6-[3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]buta-1,3-dien-2-yl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134930928) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is [(2S,3S,6S)-3-acetyl-6-[3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]buta-1,3-dien-2-yl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6S)-3-acetyl-6-[3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]buta-1,3-dien-2-yl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134930928 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [(2S,3S,6S)-3-acetyl-6-[3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]buta-1,3-dien-2-yl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | C=C(C(=C)[C@H]1C=C[C@H](OC(C)=O)CO1)[C@@H]1C=C[C@H](C(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C21H26O7/c1-12(19-8-6-17(10-26-19)27-16(5)24)13(2)20-9-7-18(14(3)22)21(28-20)11-25-15(4)23/h6-9,17-21H,1-2,10-11H2,3-5H3/t17-,18+,19+,20-,21+/m0/s1 |
| InChIKey | PKLPCOGRDFKUDM-XIYVOTBMSA-N |
| XLogP | 2.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|