C28H52O3Si2 — CID 162404894
(2R)-4-methyl-2-[tri(propan-2-yl)silyloxymethyl]-5-[3-tri(propan-2-yl)silylprop-2-ynyl]-2,5-dihydropyran-6-one (PubChem CID 162404894) has the molecular formula C28H52O3Si2 and a molecular weight of 492.89 g/mol. Its IUPAC name is (2R)-4-methyl-2-[tri(propan-2-yl)silyloxymethyl]-5-[3-tri(propan-2-yl)silylprop-2-ynyl]-2,5-dihydropyran-6-one.
| Compound Name | (2R)-4-methyl-2-[tri(propan-2-yl)silyloxymethyl]-5-[3-tri(propan-2-yl)silylprop-2-ynyl]-2,5-dihydropyran-6-one |
|---|---|
| PubChem CID | 162404894 |
| Molecular Formula | C28H52O3Si2 |
| Molecular Weight | 492.89 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | (2R)-4-methyl-2-[tri(propan-2-yl)silyloxymethyl]-5-[3-tri(propan-2-yl)silylprop-2-ynyl]-2,5-dihydropyran-6-one |
| SMILES | CC1=C[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)OC(=O)C1CC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H52O3Si2/c1-19(2)32(20(3)4,21(5)6)16-14-15-27-25(13)17-26(31-28(27)29)18-30-33(22(7)8,23(9)10)24(11)12/h17,19-24,26-27H,15,18H2,1-13H3/t26-,27?/m1/s1 |
| InChIKey | SEMSAPOGNQKHLE-AVJYQCBHSA-N |
| XLogP | 8.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.89 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|