C13H20O3 — CID 134928749
methyl (2S,3S,6S)-3-methyl-2-[(E)-pent-2-en-2-yl]-3,6-dihydro-2H-pyran-6-carboxylate (PubChem CID 134928749) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is methyl (2S,3S,6S)-3-methyl-2-[(E)-pent-2-en-2-yl]-3,6-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2S,3S,6S)-3-methyl-2-[(E)-pent-2-en-2-yl]-3,6-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 134928749 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | methyl (2S,3S,6S)-3-methyl-2-[(E)-pent-2-en-2-yl]-3,6-dihydro-2H-pyran-6-carboxylate |
| SMILES | CC/C=C(\C)[C@H]1O[C@H](C(=O)OC)C=C[C@@H]1C |
| InChI | InChI=1S/C13H20O3/c1-5-6-9(2)12-10(3)7-8-11(16-12)13(14)15-4/h6-8,10-12H,5H2,1-4H3/b9-6+/t10-,11-,12+/m0/s1 |
| InChIKey | JXCVXVSPEOBRFG-BVJHZIECSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|