C21H27ClO4S — CID 134928768
7-[(4-chlorophenyl)sulfinylmethyl]-7-methylspiro[1,2,4-trioxepane-3,2'-adamantane] (PubChem CID 134928768) has the molecular formula C21H27ClO4S and a molecular weight of 410.96 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)sulfinylmethyl]-7-methylspiro[1,2,4-trioxepane-3,2'-adamantane].
| Compound Name | 7-[(4-chlorophenyl)sulfinylmethyl]-7-methylspiro[1,2,4-trioxepane-3,2'-adamantane] |
|---|---|
| PubChem CID | 134928768 |
| Molecular Formula | C21H27ClO4S |
| Molecular Weight | 410.96 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 7-[(4-chlorophenyl)sulfinylmethyl]-7-methylspiro[1,2,4-trioxepane-3,2'-adamantane] |
| SMILES | CC1(CS(=O)c2ccc(Cl)cc2)CCOC2(OO1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C21H27ClO4S/c1-20(13-27(23)19-4-2-18(22)3-5-19)6-7-24-21(26-25-20)16-9-14-8-15(11-16)12-17(21)10-14/h2-5,14-17H,6-13H2,1H3 |
| InChIKey | HRWSWTCIDIXCPV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.96 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|