C17H23ClO4S — CID 134928767
9-[(4-chlorophenyl)sulfinylmethyl]-9-methyl-7,8,12-trioxaspiro[5.6]dodecane (PubChem CID 134928767) has the molecular formula C17H23ClO4S and a molecular weight of 358.89 g/mol. Its IUPAC name is 9-[(4-chlorophenyl)sulfinylmethyl]-9-methyl-7,8,12-trioxaspiro[5.6]dodecane.
| Compound Name | 9-[(4-chlorophenyl)sulfinylmethyl]-9-methyl-7,8,12-trioxaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 134928767 |
| Molecular Formula | C17H23ClO4S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 9-[(4-chlorophenyl)sulfinylmethyl]-9-methyl-7,8,12-trioxaspiro[5.6]dodecane |
| SMILES | CC1(CS(=O)c2ccc(Cl)cc2)CCOC2(CCCCC2)OO1 |
| InChI | InChI=1S/C17H23ClO4S/c1-16(13-23(19)15-7-5-14(18)6-8-15)11-12-20-17(22-21-16)9-3-2-4-10-17/h5-8H,2-4,9-13H2,1H3 |
| InChIKey | MCMWGHFPHKUFIZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|