C16H21ClO4S — CID 134929145
8-[(4-chlorophenyl)sulfinylmethyl]-8-methyl-6,7,11-trioxaspiro[4.6]undecane (PubChem CID 134929145) has the molecular formula C16H21ClO4S and a molecular weight of 344.86 g/mol. Its IUPAC name is 8-[(4-chlorophenyl)sulfinylmethyl]-8-methyl-6,7,11-trioxaspiro[4.6]undecane.
| Compound Name | 8-[(4-chlorophenyl)sulfinylmethyl]-8-methyl-6,7,11-trioxaspiro[4.6]undecane |
|---|---|
| PubChem CID | 134929145 |
| Molecular Formula | C16H21ClO4S |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 8-[(4-chlorophenyl)sulfinylmethyl]-8-methyl-6,7,11-trioxaspiro[4.6]undecane |
| SMILES | CC1(CS(=O)c2ccc(Cl)cc2)CCOC2(CCCC2)OO1 |
| InChI | InChI=1S/C16H21ClO4S/c1-15(12-22(18)14-6-4-13(17)5-7-14)10-11-19-16(21-20-15)8-2-3-9-16/h4-7H,2-3,8-12H2,1H3 |
| InChIKey | JIAGKNKTBHVOJL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|