C20H25ClO4S — CID 46210794
6-[(4-chlorophenyl)sulfinylmethyl]-6-methylspiro[1,2,4-trioxane-3,2'-adamantane] (PubChem CID 46210794) has the molecular formula C20H25ClO4S and a molecular weight of 396.94 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)sulfinylmethyl]-6-methylspiro[1,2,4-trioxane-3,2'-adamantane].
| Compound Name | 6-[(4-chlorophenyl)sulfinylmethyl]-6-methylspiro[1,2,4-trioxane-3,2'-adamantane] |
|---|---|
| PubChem CID | 46210794 |
| Molecular Formula | C20H25ClO4S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 6-[(4-chlorophenyl)sulfinylmethyl]-6-methylspiro[1,2,4-trioxane-3,2'-adamantane] |
| SMILES | CC1(CS(=O)c2ccc(Cl)cc2)COC2(OO1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C20H25ClO4S/c1-19(12-26(22)18-4-2-17(21)3-5-18)11-23-20(25-24-19)15-7-13-6-14(9-15)10-16(20)8-13/h2-5,13-16H,6-12H2,1H3 |
| InChIKey | PKRFRMHAAMIGNI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|