C9H15NaO6S3 — CID 134928938
sodium 5-(1,2-dicarboxyethyldisulfanyl)pentane-1-sulfinate (PubChem CID 134928938) has the molecular formula C9H15NaO6S3 and a molecular weight of 338.40 g/mol. Its IUPAC name is sodium 5-(1,2-dicarboxyethyldisulfanyl)pentane-1-sulfinate.
| Compound Name | sodium 5-(1,2-dicarboxyethyldisulfanyl)pentane-1-sulfinate |
|---|---|
| PubChem CID | 134928938 |
| Molecular Formula | C9H15NaO6S3 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | sodium 5-(1,2-dicarboxyethyldisulfanyl)pentane-1-sulfinate |
| SMILES | O=C(O)CC(SSCCCCCS(=O)[O-])C(=O)O.[Na+] |
| InChI | InChI=1S/C9H16O6S3.Na/c10-8(11)6-7(9(12)13)17-16-4-2-1-3-5-18(14)15;/h7H,1-6H2,(H,10,11)(H,12,13)(H,14,15);/q;+1/p-1 |
| InChIKey | ZKXXXLOBUHYYLJ-UHFFFAOYSA-M |
| XLogP | -1.65 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|