C6H7NaO10S — CID 23681814
sodium;2-carboxyoxysulfanylbutanedioic acid;hydrogen carbonate (PubChem CID 23681814) has the molecular formula C6H7NaO10S and a molecular weight of 294.17 g/mol. Its IUPAC name is sodium;2-carboxyoxysulfanylbutanedioic acid;hydrogen carbonate.
| Compound Name | sodium;2-carboxyoxysulfanylbutanedioic acid;hydrogen carbonate |
|---|---|
| PubChem CID | 23681814 |
| Molecular Formula | C6H7NaO10S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | sodium;2-carboxyoxysulfanylbutanedioic acid;hydrogen carbonate |
| SMILES | O=C(O)CC(SOC(=O)O)C(=O)O.O=C([O-])O.[Na+] |
| InChI | InChI=1S/C5H6O7S.CH2O3.Na/c6-3(7)1-2(4(8)9)13-12-5(10)11;2-1(3)4;/h2H,1H2,(H,6,7)(H,8,9)(H,10,11);(H2,2,3,4);/q;;+1/p-1 |
| InChIKey | YKZFEQNRTXKMEM-UHFFFAOYSA-M |
| XLogP | -3.85 |
| TPSA | 181.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|