About dilithium;10-oxidooxysulfanyldecane-1-sulfinate
dilithium;10-oxidooxysulfanyldecane-1-sulfinate (PubChem CID 20749584) has the molecular formula C10H20Li2O4S2
and a molecular weight of 282.28 g/mol. Its IUPAC name is dilithium;10-oxidooxysulfanyldecane-1-sulfinate.
Molecular Properties
| Compound Name | dilithium;10-oxidooxysulfanyldecane-1-sulfinate |
| PubChem CID | 20749584 |
| Molecular Formula | C10H20Li2O4S2 |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | dilithium;10-oxidooxysulfanyldecane-1-sulfinate |
| SMILES | O=S([O-])CCCCCCCCCCSO[O-].[Li+].[Li+] |
| InChI | InChI=1S/C10H22O4S2.2Li/c11-14-15-9-7-5-3-1-2-4-6-8-10-16(12)13;;/h11H,1-10H2,(H,12,13);;/q;2*+1/p-2 |
| InChIKey | JMRWDCLKPQXZOD-UHFFFAOYSA-L |
| XLogP | -4.07 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dilithium;10-oxidooxysulfanyldecane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;10-oxidooxysulfanyldecane-1-sulfinate?
The IUPAC name of dilithium;10-oxidooxysulfanyldecane-1-sulfinate (CID 20749584) is dilithium;10-oxidooxysulfanyldecane-1-sulfinate.
What is the SMILES notation for dilithium;10-oxidooxysulfanyldecane-1-sulfinate?
The canonical SMILES for dilithium;10-oxidooxysulfanyldecane-1-sulfinate is O=S([O-])CCCCCCCCCCSO[O-].[Li+].[Li+].
What is the InChIKey of dilithium;10-oxidooxysulfanyldecane-1-sulfinate?
The InChIKey is JMRWDCLKPQXZOD-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H22O4S2.2Li/c11-14-15-9-7-5-3-1-2-4-6-8-10-16(12)13;;/h11H,1-10H2,(H,12,13);;/q;2*+1/p-2.
What are the key properties of dilithium;10-oxidooxysulfanyldecane-1-sulfinate?
dilithium;10-oxidooxysulfanyldecane-1-sulfinate has a molecular weight of 282.28 g/mol, XLogP of -4.07, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;10-oxidooxysulfanyldecane-1-sulfinate is sourced from PubChem (CID 20749584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).