C20H20F2O5 — CID 134929167
1-[3-ethoxy-6,6-bis(4-fluorophenyl)-3-hydroxydioxan-4-yl]ethanone (PubChem CID 134929167) has the molecular formula C20H20F2O5 and a molecular weight of 378.37 g/mol. Its IUPAC name is 1-[3-ethoxy-6,6-bis(4-fluorophenyl)-3-hydroxydioxan-4-yl]ethanone.
| Compound Name | 1-[3-ethoxy-6,6-bis(4-fluorophenyl)-3-hydroxydioxan-4-yl]ethanone |
|---|---|
| PubChem CID | 134929167 |
| Molecular Formula | C20H20F2O5 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-[3-ethoxy-6,6-bis(4-fluorophenyl)-3-hydroxydioxan-4-yl]ethanone |
| SMILES | CCOC1(O)OOC(c2ccc(F)cc2)(c2ccc(F)cc2)CC1C(C)=O |
| InChI | InChI=1S/C20H20F2O5/c1-3-25-20(24)18(13(2)23)12-19(26-27-20,14-4-8-16(21)9-5-14)15-6-10-17(22)11-7-15/h4-11,18,24H,3,12H2,1-2H3 |
| InChIKey | DZDCORSZUUMBBR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|