C19H17F3N2O4 — CID 134929478
2-(2-methoxy-4-prop-2-enylphenoxy)-4-methylbenzenediazonium;2,2,2-trifluoroacetate (PubChem CID 134929478) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is 2-(2-methoxy-4-prop-2-enylphenoxy)-4-methylbenzenediazonium;2,2,2-trifluoroacetate.
| Compound Name | 2-(2-methoxy-4-prop-2-enylphenoxy)-4-methylbenzenediazonium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 134929478 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-(2-methoxy-4-prop-2-enylphenoxy)-4-methylbenzenediazonium;2,2,2-trifluoroacetate |
| SMILES | C=CCc1ccc(Oc2cc(C)ccc2[N+]#N)c(OC)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C17H17N2O2.C2HF3O2/c1-4-5-13-7-9-15(17(11-13)20-3)21-16-10-12(2)6-8-14(16)19-18;3-2(4,5)1(6)7/h4,6-11H,1,5H2,2-3H3;(H,6,7)/q+1;/p-1 |
| InChIKey | FNLHPGCMCREBDE-UHFFFAOYSA-M |
| XLogP | 4.31 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|