C14H17NO3 — CID 134930763
(1R)-1-[(4S,5S)-4-(hydroxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]but-3-en-1-ol (PubChem CID 134930763) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (1R)-1-[(4S,5S)-4-(hydroxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]but-3-en-1-ol.
| Compound Name | (1R)-1-[(4S,5S)-4-(hydroxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 134930763 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (1R)-1-[(4S,5S)-4-(hydroxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]but-3-en-1-ol |
| SMILES | C=CC[C@@H](O)C1=N[C@@H](CO)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C14H17NO3/c1-2-6-12(17)14-15-11(9-16)13(18-14)10-7-4-3-5-8-10/h2-5,7-8,11-13,16-17H,1,6,9H2/t11-,12+,13-/m0/s1 |
| InChIKey | FMTHZFFYSQSFRA-XQQFMLRXSA-N |
| XLogP | 1.45 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|