C18H25NO2 — CID 134931077
(3S,5S)-1-benzyl-3-cyclohexyl-5-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 134931077) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (3S,5S)-1-benzyl-3-cyclohexyl-5-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | (3S,5S)-1-benzyl-3-cyclohexyl-5-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 134931077 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (3S,5S)-1-benzyl-3-cyclohexyl-5-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | O=C1[C@H](C2CCCCC2)C[C@@H](CO)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H25NO2/c20-13-16-11-17(15-9-5-2-6-10-15)18(21)19(16)12-14-7-3-1-4-8-14/h1,3-4,7-8,15-17,20H,2,5-6,9-13H2/t16-,17-/m0/s1 |
| InChIKey | FOOQZKYNPLDUQD-IRXDYDNUSA-N |
| XLogP | 2.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |