C21H34O2 — CID 134931123
(1S,2S,3R)-2-[(1R)-1-hydroxynonyl]-3-methyl-1-(2-phenylethyl)cyclopropan-1-ol (PubChem CID 134931123) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (1S,2S,3R)-2-[(1R)-1-hydroxynonyl]-3-methyl-1-(2-phenylethyl)cyclopropan-1-ol.
| Compound Name | (1S,2S,3R)-2-[(1R)-1-hydroxynonyl]-3-methyl-1-(2-phenylethyl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 134931123 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (1S,2S,3R)-2-[(1R)-1-hydroxynonyl]-3-methyl-1-(2-phenylethyl)cyclopropan-1-ol |
| SMILES | CCCCCCCC[C@@H](O)[C@@H]1[C@@H](C)[C@@]1(O)CCc1ccccc1 |
| InChI | InChI=1S/C21H34O2/c1-3-4-5-6-7-11-14-19(22)20-17(2)21(20,23)16-15-18-12-9-8-10-13-18/h8-10,12-13,17,19-20,22-23H,3-7,11,14-16H2,1-2H3/t17-,19-,20+,21+/m1/s1 |
| InChIKey | ADPDLXPLQLCVHR-PBASOCQRSA-N |
| XLogP | 4.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|