C28H48O3 — CID 134931154
(1S,2R,5S,6R,7R,9R,11S,12S,15R,16R)-5-methoxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-6-ol (PubChem CID 134931154) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is (1S,2R,5S,6R,7R,9R,11S,12S,15R,16R)-5-methoxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-6-ol.
| Compound Name | (1S,2R,5S,6R,7R,9R,11S,12S,15R,16R)-5-methoxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-6-ol |
|---|---|
| PubChem CID | 134931154 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | (1S,2R,5S,6R,7R,9R,11S,12S,15R,16R)-5-methoxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-6-ol |
| SMILES | CO[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]4[C@@H]3C[C@H]3O[C@]32[C@@H]1O |
| InChI | InChI=1S/C28H48O3/c1-17(2)8-7-9-18(3)20-10-11-21-19-16-24-28(31-24)25(29)23(30-6)13-15-27(28,5)22(19)12-14-26(20,21)4/h17-25,29H,7-16H2,1-6H3/t18-,19+,20-,21+,22+,23+,24-,25-,26-,27-,28+/m1/s1 |
| InChIKey | DZTNBGSGFGLREX-MISHLHQHSA-N |
| XLogP | 6.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|