C30H50O3 — CID 125029942
(1R,3S,5S,6R,9S,10S,13S,14R,17R,21R)-10,14,19,19-tetramethyl-9-[(2S)-6-methylheptan-2-yl]-2,18,20-trioxahexacyclo[12.7.0.01,3.05,13.06,10.017,21]henicosane (PubChem CID 125029942) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is (1R,3S,5S,6R,9S,10S,13S,14R,17R,21R)-10,14,19,19-tetramethyl-9-[(2S)-6-methylheptan-2-yl]-2,18,20-trioxahexacyclo[12.7.0.01,3.05,13.06,10.017,21]henicosane.
| Compound Name | (1R,3S,5S,6R,9S,10S,13S,14R,17R,21R)-10,14,19,19-tetramethyl-9-[(2S)-6-methylheptan-2-yl]-2,18,20-trioxahexacyclo[12.7.0.01,3.05,13.06,10.017,21]henicosane |
|---|---|
| PubChem CID | 125029942 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | (1R,3S,5S,6R,9S,10S,13S,14R,17R,21R)-10,14,19,19-tetramethyl-9-[(2S)-6-methylheptan-2-yl]-2,18,20-trioxahexacyclo[12.7.0.01,3.05,13.06,10.017,21]henicosane |
| SMILES | CC(C)CCC[C@H](C)[C@@H]1CC[C@@H]2[C@@H]3C[C@@H]4O[C@@]45[C@@H]4OC(C)(C)O[C@@H]4CC[C@]5(C)[C@H]3CC[C@]21C |
| InChI | InChI=1S/C30H50O3/c1-18(2)9-8-10-19(3)21-11-12-22-20-17-25-30(32-25)26-24(31-27(4,5)33-26)14-16-29(30,7)23(20)13-15-28(21,22)6/h18-26H,8-17H2,1-7H3/t19-,20-,21-,22+,23-,24+,25-,26+,28-,29+,30+/m0/s1 |
| InChIKey | AAJXVQUPOZZQLH-GXJCBKHJSA-N |
| XLogP | 7.37 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|