C18H21BrO3S — CID 134931172
(1R,2R)-1-(2-bromophenyl)-1-(4-methylphenyl)sulfonylpentan-2-ol (PubChem CID 134931172) has the molecular formula C18H21BrO3S and a molecular weight of 397.33 g/mol. Its IUPAC name is (1R,2R)-1-(2-bromophenyl)-1-(4-methylphenyl)sulfonylpentan-2-ol.
| Compound Name | (1R,2R)-1-(2-bromophenyl)-1-(4-methylphenyl)sulfonylpentan-2-ol |
|---|---|
| PubChem CID | 134931172 |
| Molecular Formula | C18H21BrO3S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (1R,2R)-1-(2-bromophenyl)-1-(4-methylphenyl)sulfonylpentan-2-ol |
| SMILES | CCC[C@@H](O)[C@@H](c1ccccc1Br)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21BrO3S/c1-3-6-17(20)18(15-7-4-5-8-16(15)19)23(21,22)14-11-9-13(2)10-12-14/h4-5,7-12,17-18,20H,3,6H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | QQLKUAQKUOGUKV-QZTJIDSGSA-N |
| XLogP | 4.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |