C12H11N3O5S — CID 134931174
5-[1-hydroxy-2-(4-nitrophenyl)sulfanylethyl]-1H-pyrimidine-2,4-dione (PubChem CID 134931174) has the molecular formula C12H11N3O5S and a molecular weight of 309.30 g/mol. Its IUPAC name is 5-[1-hydroxy-2-(4-nitrophenyl)sulfanylethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[1-hydroxy-2-(4-nitrophenyl)sulfanylethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134931174 |
| Molecular Formula | C12H11N3O5S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 5-[1-hydroxy-2-(4-nitrophenyl)sulfanylethyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(C(O)CSc2ccc([N+](=O)[O-])cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H11N3O5S/c16-10(9-5-13-12(18)14-11(9)17)6-21-8-3-1-7(2-4-8)15(19)20/h1-5,10,16H,6H2,(H2,13,14,17,18) |
| InChIKey | PYJBTQCFATYBKY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|