C15H11N5O8 — CID 32953032
6-hydroxy-5-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)-(4-nitrophenyl)methyl]-1H-pyrimidine-2,4-dione (PubChem CID 32953032) has the molecular formula C15H11N5O8 and a molecular weight of 389.28 g/mol. Its IUPAC name is 6-hydroxy-5-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)-(4-nitrophenyl)methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)-(4-nitrophenyl)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 32953032 |
| Molecular Formula | C15H11N5O8 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 6-hydroxy-5-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)-(4-nitrophenyl)methyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(C(c2ccc([N+](=O)[O-])cc2)c2c(O)[nH]c(=O)[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C15H11N5O8/c21-10-8(11(22)17-14(25)16-10)7(5-1-3-6(4-2-5)20(27)28)9-12(23)18-15(26)19-13(9)24/h1-4,7H,(H3,16,17,21,22,25)(H3,18,19,23,24,26) |
| InChIKey | KGEVNUIMBITQRS-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 215.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|