C24H34O6 — CID 134931469
[(2R,3S,6S)-3-acetyloxy-6-(3,4-ditert-butyl-2-hydroxyphenyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134931469) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-(3,4-ditert-butyl-2-hydroxyphenyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-(3,4-ditert-butyl-2-hydroxyphenyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134931469 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-(3,4-ditert-butyl-2-hydroxyphenyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](c2ccc(C(C)(C)C)c(C(C)(C)C)c2O)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H34O6/c1-14(25)28-13-20-19(29-15(2)26)12-11-18(30-20)16-9-10-17(23(3,4)5)21(22(16)27)24(6,7)8/h9-12,18-20,27H,13H2,1-8H3/t18-,19-,20+/m0/s1 |
| InChIKey | XDCFZKJSZHNABO-SLFFLAALSA-N |
| XLogP | 4.48 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|