C17H12F6OSe2 — CID 134931865
(E)-2,3-bis[[4-(trifluoromethyl)phenyl]selanyl]prop-2-en-1-ol (PubChem CID 134931865) has the molecular formula C17H12F6OSe2 and a molecular weight of 504.19 g/mol. Its IUPAC name is (E)-2,3-bis[[4-(trifluoromethyl)phenyl]selanyl]prop-2-en-1-ol.
| Compound Name | (E)-2,3-bis[[4-(trifluoromethyl)phenyl]selanyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 134931865 |
| Molecular Formula | C17H12F6OSe2 |
| Molecular Weight | 504.19 g/mol |
| Exact Mass | 505.91 |
| IUPAC Name | (E)-2,3-bis[[4-(trifluoromethyl)phenyl]selanyl]prop-2-en-1-ol |
| SMILES | OC/C(=C\[Se]c1ccc(C(F)(F)F)cc1)[Se]c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F6OSe2/c18-16(19,20)11-1-5-13(6-2-11)25-10-15(9-24)26-14-7-3-12(4-8-14)17(21,22)23/h1-8,10,24H,9H2/b15-10+ |
| InChIKey | UMWMAYVYWNOJQV-XNTDXEJSSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|