C27H38O3Se — CID 134931871
(4Z)-1-phenyl-4-(phenylselenonylmethylidene)tetradecan-3-ol (PubChem CID 134931871) has the molecular formula C27H38O3Se and a molecular weight of 489.56 g/mol. Its IUPAC name is (4Z)-1-phenyl-4-(phenylselenonylmethylidene)tetradecan-3-ol.
| Compound Name | (4Z)-1-phenyl-4-(phenylselenonylmethylidene)tetradecan-3-ol |
|---|---|
| PubChem CID | 134931871 |
| Molecular Formula | C27H38O3Se |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (4Z)-1-phenyl-4-(phenylselenonylmethylidene)tetradecan-3-ol |
| SMILES | CCCCCCCCCC/C(=C/[Se](=O)(=O)c1ccccc1)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C27H38O3Se/c1-2-3-4-5-6-7-8-13-18-25(23-31(29,30)26-19-14-10-15-20-26)27(28)22-21-24-16-11-9-12-17-24/h9-12,14-17,19-20,23,27-28H,2-8,13,18,21-22H2,1H3/b25-23- |
| InChIKey | ADECBIYXWZQQKF-BZZOAKBMSA-N |
| XLogP | 6.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|