C20H38Te — CID 134932519
(7E,9E)-7-butyltellanylhexadeca-7,9-diene (PubChem CID 134932519) has the molecular formula C20H38Te and a molecular weight of 406.12 g/mol. Its IUPAC name is (7E,9E)-7-butyltellanylhexadeca-7,9-diene.
| Compound Name | (7E,9E)-7-butyltellanylhexadeca-7,9-diene |
|---|---|
| PubChem CID | 134932519 |
| Molecular Formula | C20H38Te |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (7E,9E)-7-butyltellanylhexadeca-7,9-diene |
| SMILES | CCCCCC/C=C/C=C(\CCCCCC)[Te]CCCC |
| InChI | InChI=1S/C20H38Te/c1-4-7-10-12-13-14-16-18-20(21-19-9-6-3)17-15-11-8-5-2/h14,16,18H,4-13,15,17,19H2,1-3H3/b16-14+,20-18+ |
| InChIKey | FFXBPAJSJWQTKG-JMMKMDTASA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|