C25H29NO3 — CID 134933001
ethyl 2-benzyl-4-cyclohexyl-3-phenyl-3H-1,2-oxazole-5-carboxylate (PubChem CID 134933001) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is ethyl 2-benzyl-4-cyclohexyl-3-phenyl-3H-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 2-benzyl-4-cyclohexyl-3-phenyl-3H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 134933001 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | ethyl 2-benzyl-4-cyclohexyl-3-phenyl-3H-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C2CCCCC2)C(c2ccccc2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C25H29NO3/c1-2-28-25(27)24-22(20-14-8-4-9-15-20)23(21-16-10-5-11-17-21)26(29-24)18-19-12-6-3-7-13-19/h3,5-7,10-13,16-17,20,23H,2,4,8-9,14-15,18H2,1H3 |
| InChIKey | XNKYAPGRWXMRJA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |