C13H13F14O4P — CID 134933013
diethyl [(E)-3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoronon-2-en-2-yl] phosphate (PubChem CID 134933013) has the molecular formula C13H13F14O4P and a molecular weight of 530.19 g/mol. Its IUPAC name is diethyl [(E)-3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoronon-2-en-2-yl] phosphate.
| Compound Name | diethyl [(E)-3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoronon-2-en-2-yl] phosphate |
|---|---|
| PubChem CID | 134933013 |
| Molecular Formula | C13H13F14O4P |
| Molecular Weight | 530.19 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | diethyl [(E)-3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoronon-2-en-2-yl] phosphate |
| SMILES | CCOP(=O)(OCC)O/C(C)=C(/F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H13F14O4P/c1-4-29-32(28,30-5-2)31-6(3)7(14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)27/h4-5H2,1-3H3/b7-6+ |
| InChIKey | PQZVGQBDGDLUKG-VOTSOKGWSA-N |
| XLogP | 7.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.19 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|