C16H19F14O4P — CID 134931917
diethyl [(E)-5,6,6,7,7,8,8,9,9,10,10,11,11,11-tetradecafluoro-2-methylundec-4-en-4-yl] phosphate (PubChem CID 134931917) has the molecular formula C16H19F14O4P and a molecular weight of 572.27 g/mol. Its IUPAC name is diethyl [(E)-5,6,6,7,7,8,8,9,9,10,10,11,11,11-tetradecafluoro-2-methylundec-4-en-4-yl] phosphate.
| Compound Name | diethyl [(E)-5,6,6,7,7,8,8,9,9,10,10,11,11,11-tetradecafluoro-2-methylundec-4-en-4-yl] phosphate |
|---|---|
| PubChem CID | 134931917 |
| Molecular Formula | C16H19F14O4P |
| Molecular Weight | 572.27 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | diethyl [(E)-5,6,6,7,7,8,8,9,9,10,10,11,11,11-tetradecafluoro-2-methylundec-4-en-4-yl] phosphate |
| SMILES | CCOP(=O)(OCC)O/C(CC(C)C)=C(/F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H19F14O4P/c1-5-32-35(31,33-6-2)34-9(7-8(3)4)10(17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)30/h8H,5-7H2,1-4H3/b10-9+ |
| InChIKey | YBZRPDAYPDLDNZ-MDZDMXLPSA-N |
| XLogP | 8.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.27 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|