C11H19F4O4P — CID 134932417
diethyl [(E)-1,1,1,2-tetrafluoro-5-methylhex-2-en-3-yl] phosphate (PubChem CID 134932417) has the molecular formula C11H19F4O4P and a molecular weight of 322.24 g/mol. Its IUPAC name is diethyl [(E)-1,1,1,2-tetrafluoro-5-methylhex-2-en-3-yl] phosphate.
| Compound Name | diethyl [(E)-1,1,1,2-tetrafluoro-5-methylhex-2-en-3-yl] phosphate |
|---|---|
| PubChem CID | 134932417 |
| Molecular Formula | C11H19F4O4P |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | diethyl [(E)-1,1,1,2-tetrafluoro-5-methylhex-2-en-3-yl] phosphate |
| SMILES | CCOP(=O)(OCC)O/C(CC(C)C)=C(/F)C(F)(F)F |
| InChI | InChI=1S/C11H19F4O4P/c1-5-17-20(16,18-6-2)19-9(7-8(3)4)10(12)11(13,14)15/h8H,5-7H2,1-4H3/b10-9+ |
| InChIKey | OQVQDVUWMXRYKZ-MDZDMXLPSA-N |
| XLogP | 4.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|