C12H17F6O4P — CID 134932321
diethyl [(3E)-1,1,1,2,2,3-hexafluoroocta-3,7-dien-4-yl] phosphate (PubChem CID 134932321) has the molecular formula C12H17F6O4P and a molecular weight of 370.23 g/mol. Its IUPAC name is diethyl [(3E)-1,1,1,2,2,3-hexafluoroocta-3,7-dien-4-yl] phosphate.
| Compound Name | diethyl [(3E)-1,1,1,2,2,3-hexafluoroocta-3,7-dien-4-yl] phosphate |
|---|---|
| PubChem CID | 134932321 |
| Molecular Formula | C12H17F6O4P |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | diethyl [(3E)-1,1,1,2,2,3-hexafluoroocta-3,7-dien-4-yl] phosphate |
| SMILES | C=CCC/C(OP(=O)(OCC)OCC)=C(\F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F6O4P/c1-4-7-8-9(10(13)11(14,15)12(16,17)18)22-23(19,20-5-2)21-6-3/h4H,1,5-8H2,2-3H3/b10-9+ |
| InChIKey | PUQQWHSXOVMVPT-MDZDMXLPSA-N |
| XLogP | 5.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|