C11H17F4O4P — CID 134933096
diethyl [(2E)-1,1,1,2-tetrafluorohepta-2,6-dien-3-yl] phosphate (PubChem CID 134933096) has the molecular formula C11H17F4O4P and a molecular weight of 320.22 g/mol. Its IUPAC name is diethyl [(2E)-1,1,1,2-tetrafluorohepta-2,6-dien-3-yl] phosphate.
| Compound Name | diethyl [(2E)-1,1,1,2-tetrafluorohepta-2,6-dien-3-yl] phosphate |
|---|---|
| PubChem CID | 134933096 |
| Molecular Formula | C11H17F4O4P |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | diethyl [(2E)-1,1,1,2-tetrafluorohepta-2,6-dien-3-yl] phosphate |
| SMILES | C=CCC/C(OP(=O)(OCC)OCC)=C(\F)C(F)(F)F |
| InChI | InChI=1S/C11H17F4O4P/c1-4-7-8-9(10(12)11(13,14)15)19-20(16,17-5-2)18-6-3/h4H,1,5-8H2,2-3H3/b10-9+ |
| InChIKey | ZLYIFLZOKUGEMO-MDZDMXLPSA-N |
| XLogP | 4.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|