C12H19F6O4P — CID 134931909
diethyl [(E)-1,1,1,2,2,3-hexafluoro-6-methylhept-3-en-4-yl] phosphate (PubChem CID 134931909) has the molecular formula C12H19F6O4P and a molecular weight of 372.24 g/mol. Its IUPAC name is diethyl [(E)-1,1,1,2,2,3-hexafluoro-6-methylhept-3-en-4-yl] phosphate.
| Compound Name | diethyl [(E)-1,1,1,2,2,3-hexafluoro-6-methylhept-3-en-4-yl] phosphate |
|---|---|
| PubChem CID | 134931909 |
| Molecular Formula | C12H19F6O4P |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | diethyl [(E)-1,1,1,2,2,3-hexafluoro-6-methylhept-3-en-4-yl] phosphate |
| SMILES | CCOP(=O)(OCC)O/C(CC(C)C)=C(/F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H19F6O4P/c1-5-20-23(19,21-6-2)22-9(7-8(3)4)10(13)11(14,15)12(16,17)18/h8H,5-7H2,1-4H3/b10-9+ |
| InChIKey | QSPKBGXECVBJIA-MDZDMXLPSA-N |
| XLogP | 5.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|