C17H21F14O4P — CID 134932812
diethyl [(E)-6,7,7,8,8,9,9,10,10,11,11,12,12,12-tetradecafluoro-2-methyldodec-5-en-5-yl] phosphate (PubChem CID 134932812) has the molecular formula C17H21F14O4P and a molecular weight of 586.30 g/mol. Its IUPAC name is diethyl [(E)-6,7,7,8,8,9,9,10,10,11,11,12,12,12-tetradecafluoro-2-methyldodec-5-en-5-yl] phosphate.
| Compound Name | diethyl [(E)-6,7,7,8,8,9,9,10,10,11,11,12,12,12-tetradecafluoro-2-methyldodec-5-en-5-yl] phosphate |
|---|---|
| PubChem CID | 134932812 |
| Molecular Formula | C17H21F14O4P |
| Molecular Weight | 586.30 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | diethyl [(E)-6,7,7,8,8,9,9,10,10,11,11,12,12,12-tetradecafluoro-2-methyldodec-5-en-5-yl] phosphate |
| SMILES | CCOP(=O)(OCC)O/C(CCC(C)C)=C(/F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H21F14O4P/c1-5-33-36(32,34-6-2)35-10(8-7-9(3)4)11(18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)31/h9H,5-8H2,1-4H3/b11-10+ |
| InChIKey | GIJAGDOMYWTNMR-ZHACJKMWSA-N |
| XLogP | 8.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.30 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|