C18H21F14O4P — CID 134932309
[(E)-1-cyclohexyl-2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooct-1-enyl] diethyl phosphate (PubChem CID 134932309) has the molecular formula C18H21F14O4P and a molecular weight of 598.31 g/mol. Its IUPAC name is [(E)-1-cyclohexyl-2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooct-1-enyl] diethyl phosphate.
| Compound Name | [(E)-1-cyclohexyl-2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooct-1-enyl] diethyl phosphate |
|---|---|
| PubChem CID | 134932309 |
| Molecular Formula | C18H21F14O4P |
| Molecular Weight | 598.31 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | [(E)-1-cyclohexyl-2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooct-1-enyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C(/F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C18H21F14O4P/c1-3-34-37(33,35-4-2)36-11(10-8-6-5-7-9-10)12(19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)18(30,31)32/h10H,3-9H2,1-2H3/b12-11+ |
| InChIKey | ZCTCDSNWURCAHC-VAWYXSNFSA-N |
| XLogP | 8.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.31 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|