C14H23F6O4P — CID 102056084
diethyl [(E)-1,1,1,2,2,3-hexafluorodec-3-en-4-yl] phosphate (PubChem CID 102056084) has the molecular formula C14H23F6O4P and a molecular weight of 400.30 g/mol. Its IUPAC name is diethyl [(E)-1,1,1,2,2,3-hexafluorodec-3-en-4-yl] phosphate.
| Compound Name | diethyl [(E)-1,1,1,2,2,3-hexafluorodec-3-en-4-yl] phosphate |
|---|---|
| PubChem CID | 102056084 |
| Molecular Formula | C14H23F6O4P |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | diethyl [(E)-1,1,1,2,2,3-hexafluorodec-3-en-4-yl] phosphate |
| SMILES | CCCCCC/C(OP(=O)(OCC)OCC)=C(\F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H23F6O4P/c1-4-7-8-9-10-11(12(15)13(16,17)14(18,19)20)24-25(21,22-5-2)23-6-3/h4-10H2,1-3H3/b12-11+ |
| InChIKey | HRRXVTMSMQEDGD-VAWYXSNFSA-N |
| XLogP | 6.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|