C12H21F4O4P — CID 134932418
diethyl [(E)-1,1,1,2-tetrafluoro-6-methylhept-2-en-3-yl] phosphate (PubChem CID 134932418) has the molecular formula C12H21F4O4P and a molecular weight of 336.26 g/mol. Its IUPAC name is diethyl [(E)-1,1,1,2-tetrafluoro-6-methylhept-2-en-3-yl] phosphate.
| Compound Name | diethyl [(E)-1,1,1,2-tetrafluoro-6-methylhept-2-en-3-yl] phosphate |
|---|---|
| PubChem CID | 134932418 |
| Molecular Formula | C12H21F4O4P |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | diethyl [(E)-1,1,1,2-tetrafluoro-6-methylhept-2-en-3-yl] phosphate |
| SMILES | CCOP(=O)(OCC)O/C(CCC(C)C)=C(/F)C(F)(F)F |
| InChI | InChI=1S/C12H21F4O4P/c1-5-18-21(17,19-6-2)20-10(8-7-9(3)4)11(13)12(14,15)16/h9H,5-8H2,1-4H3/b11-10+ |
| InChIKey | UWHBYISPOBSUFV-ZHACJKMWSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|