C23H34O5SSi — CID 134933293
[(8S,9E)-10-(benzenesulfonyl)-8-methyl-4-oxo-2-(trimethylsilylmethyl)deca-1,9-dien-3-yl] acetate (PubChem CID 134933293) has the molecular formula C23H34O5SSi and a molecular weight of 450.67 g/mol. Its IUPAC name is [(8S,9E)-10-(benzenesulfonyl)-8-methyl-4-oxo-2-(trimethylsilylmethyl)deca-1,9-dien-3-yl] acetate.
| Compound Name | [(8S,9E)-10-(benzenesulfonyl)-8-methyl-4-oxo-2-(trimethylsilylmethyl)deca-1,9-dien-3-yl] acetate |
|---|---|
| PubChem CID | 134933293 |
| Molecular Formula | C23H34O5SSi |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [(8S,9E)-10-(benzenesulfonyl)-8-methyl-4-oxo-2-(trimethylsilylmethyl)deca-1,9-dien-3-yl] acetate |
| SMILES | C=C(C[Si](C)(C)C)C(OC(C)=O)C(=O)CCC[C@H](C)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H34O5SSi/c1-18(15-16-29(26,27)21-12-8-7-9-13-21)11-10-14-22(25)23(28-20(3)24)19(2)17-30(4,5)6/h7-9,12-13,15-16,18,23H,2,10-11,14,17H2,1,3-6H3/b16-15+/t18-,23?/m0/s1 |
| InChIKey | FAPJFCXPDIDJHG-KEZDPJPOSA-N |
| XLogP | 5.18 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|