C22H30O10 — CID 134933344
tetraethyl (3E,5E)-2,7-dimethoxyocta-1,3,5,7-tetraene-1,1,8,8-tetracarboxylate (PubChem CID 134933344) has the molecular formula C22H30O10 and a molecular weight of 454.47 g/mol. Its IUPAC name is tetraethyl (3E,5E)-2,7-dimethoxyocta-1,3,5,7-tetraene-1,1,8,8-tetracarboxylate.
| Compound Name | tetraethyl (3E,5E)-2,7-dimethoxyocta-1,3,5,7-tetraene-1,1,8,8-tetracarboxylate |
|---|---|
| PubChem CID | 134933344 |
| Molecular Formula | C22H30O10 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | tetraethyl (3E,5E)-2,7-dimethoxyocta-1,3,5,7-tetraene-1,1,8,8-tetracarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C(/C=C/C=C/C(OC)=C(C(=O)OCC)C(=O)OCC)OC |
| InChI | InChI=1S/C22H30O10/c1-7-29-19(23)17(20(24)30-8-2)15(27-5)13-11-12-14-16(28-6)18(21(25)31-9-3)22(26)32-10-4/h11-14H,7-10H2,1-6H3/b13-11+,14-12+ |
| InChIKey | FMEDJLUGBUGBPX-PHEQNACWSA-N |
| XLogP | 2.15 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|