C20H26O10 — CID 134879357
tetraethyl (3E,5E)-2,7-dihydroxyocta-1,3,5,7-tetraene-1,1,8,8-tetracarboxylate (PubChem CID 134879357) has the molecular formula C20H26O10 and a molecular weight of 426.42 g/mol. Its IUPAC name is tetraethyl (3E,5E)-2,7-dihydroxyocta-1,3,5,7-tetraene-1,1,8,8-tetracarboxylate.
| Compound Name | tetraethyl (3E,5E)-2,7-dihydroxyocta-1,3,5,7-tetraene-1,1,8,8-tetracarboxylate |
|---|---|
| PubChem CID | 134879357 |
| Molecular Formula | C20H26O10 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | tetraethyl (3E,5E)-2,7-dihydroxyocta-1,3,5,7-tetraene-1,1,8,8-tetracarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C(O)/C=C/C=C/C(O)=C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H26O10/c1-5-27-17(23)15(18(24)28-6-2)13(21)11-9-10-12-14(22)16(19(25)29-7-3)20(26)30-8-4/h9-12,21-22H,5-8H2,1-4H3/b11-9+,12-10+ |
| InChIKey | ZFNCSPXWQGLUCP-WGDLNXRISA-N |
| XLogP | 1.98 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|