About (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine
(2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine (PubChem CID 134933972) has the molecular formula C11H24N3OP
and a molecular weight of 245.31 g/mol. Its IUPAC name is (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine.
Molecular Properties
| Compound Name | (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine |
| PubChem CID | 134933972 |
| Molecular Formula | C11H24N3OP |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine |
| SMILES | C=CCC/C=C(/C)NP(=O)(N(C)C)N(C)C |
| InChI | InChI=1S/C11H24N3OP/c1-7-8-9-10-11(2)12-16(15,13(3)4)14(5)6/h7,10H,1,8-9H2,2-6H3,(H,12,15)/b11-10- |
| InChIKey | ZHMOKJNWVLXEOH-KHPPLWFESA-N |
| XLogP | 2.68 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine?
The IUPAC name of (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine (CID 134933972) is (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine.
What is the SMILES notation for (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine?
The canonical SMILES for (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine is C=CCC/C=C(/C)NP(=O)(N(C)C)N(C)C.
What is the InChIKey of (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine?
The InChIKey is ZHMOKJNWVLXEOH-KHPPLWFESA-N. The full InChI is InChI=1S/C11H24N3OP/c1-7-8-9-10-11(2)12-16(15,13(3)4)14(5)6/h7,10H,1,8-9H2,2-6H3,(H,12,15)/b11-10-.
What are the key properties of (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine?
(2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine has a molecular weight of 245.31 g/mol, XLogP of 2.68, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-[bis(dimethylamino)phosphoryl]hepta-2,6-dien-2-amine is sourced from PubChem (CID 134933972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).