C15H17N3O2S — CID 134935246
2,6-dimethoxy-N-[(E)-phenylsulfanylmethyldiazenyl]aniline (PubChem CID 134935246) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[(E)-phenylsulfanylmethyldiazenyl]aniline.
| Compound Name | 2,6-dimethoxy-N-[(E)-phenylsulfanylmethyldiazenyl]aniline |
|---|---|
| PubChem CID | 134935246 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2,6-dimethoxy-N-[(E)-phenylsulfanylmethyldiazenyl]aniline |
| SMILES | COc1cccc(OC)c1N/N=N/CSc1ccccc1 |
| InChI | InChI=1S/C15H17N3O2S/c1-19-13-9-6-10-14(20-2)15(13)17-18-16-11-21-12-7-4-3-5-8-12/h3-10H,11H2,1-2H3,(H,16,17) |
| InChIKey | PJYJOPKMGFSOME-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|