C16H9BrClNO4 — CID 134936770
1-bromo-5-chloro-2,3-dimethyl-8-nitroanthracene-9,10-dione (PubChem CID 134936770) has the molecular formula C16H9BrClNO4 and a molecular weight of 394.61 g/mol. Its IUPAC name is 1-bromo-5-chloro-2,3-dimethyl-8-nitroanthracene-9,10-dione.
| Compound Name | 1-bromo-5-chloro-2,3-dimethyl-8-nitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 134936770 |
| Molecular Formula | C16H9BrClNO4 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 392.94 |
| IUPAC Name | 1-bromo-5-chloro-2,3-dimethyl-8-nitroanthracene-9,10-dione |
| SMILES | Cc1cc2c(c(Br)c1C)C(=O)c1c([N+](=O)[O-])ccc(Cl)c1C2=O |
| InChI | InChI=1S/C16H9BrClNO4/c1-6-5-8-11(14(17)7(6)2)16(21)13-10(19(22)23)4-3-9(18)12(13)15(8)20/h3-5H,1-2H3 |
| InChIKey | AULFBGOEWCCDNY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|