C16H10ClNO4 — CID 134936639
1-chloro-6,7-dimethyl-4-nitroanthracene-9,10-dione (PubChem CID 134936639) has the molecular formula C16H10ClNO4 and a molecular weight of 315.71 g/mol. Its IUPAC name is 1-chloro-6,7-dimethyl-4-nitroanthracene-9,10-dione.
| Compound Name | 1-chloro-6,7-dimethyl-4-nitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 134936639 |
| Molecular Formula | C16H10ClNO4 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 1-chloro-6,7-dimethyl-4-nitroanthracene-9,10-dione |
| SMILES | Cc1cc2c(cc1C)C(=O)c1c([N+](=O)[O-])ccc(Cl)c1C2=O |
| InChI | InChI=1S/C16H10ClNO4/c1-7-5-9-10(6-8(7)2)16(20)14-12(18(21)22)4-3-11(17)13(14)15(9)19/h3-6H,1-2H3 |
| InChIKey | GIRGSZWFUJIRIV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|